EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H35N5O5 |
| Net Charge | 0 |
| Average Mass | 569.662 |
| Monoisotopic Mass | 569.26382 |
| SMILES | COc1ccc(CN(C(=O)[C@@H](N)Cc2c(C)cc(C(N)=O)cc2C)[C@@H](C)c2ncc(-c3ccccc3)n2)cc1C(=O)O |
| InChI | InChI=1S/C32H35N5O5/c1-18-12-23(29(34)38)13-19(2)24(18)15-26(33)31(39)37(17-21-10-11-28(42-4)25(14-21)32(40)41)20(3)30-35-16-27(36-30)22-8-6-5-7-9-22/h5-14,16,20,26H,15,17,33H2,1-4H3,(H2,34,38)(H,35,36)(H,40,41)/t20-,26-/m0/s1 |
| InChIKey | QFNHIDANIVGXPE-FNZWTVRRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | delta-opioid receptor antagonist Any compound that exhibits antagonist activity at the δ-opioid receptor. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. kappa-opioid receptor agonist A compound that exhibits agonist activity at the κ-opioid receptor. |
| Applications: | delta-opioid receptor antagonist Any compound that exhibits antagonist activity at the δ-opioid receptor. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. kappa-opioid receptor agonist A compound that exhibits agonist activity at the κ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eluxadoline (CHEBI:85980) has role gastrointestinal drug (CHEBI:55324) |
| eluxadoline (CHEBI:85980) has role δ-opioid receptor antagonist (CHEBI:59283) |
| eluxadoline (CHEBI:85980) has role κ-opioid receptor agonist (CHEBI:59282) |
| eluxadoline (CHEBI:85980) has role μ-opioid receptor agonist (CHEBI:55322) |
| eluxadoline (CHEBI:85980) is a L-phenylalanine derivative (CHEBI:84144) |
| eluxadoline (CHEBI:85980) is a amino acid amide (CHEBI:22475) |
| eluxadoline (CHEBI:85980) is a benzamides (CHEBI:22702) |
| eluxadoline (CHEBI:85980) is a imidazoles (CHEBI:24780) |
| eluxadoline (CHEBI:85980) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 5-({(4-carbamoyl-2,6-dimethyl-L-phenylalanyl)[(1S)-1-(4-phenyl-1H-imidazol-2-yl)ethyl]amino}methyl)-2-methoxybenzoic acid |
| INN | Source |
|---|---|
| eluxadoline | ChemIDplus |
| Brand Name | Source |
|---|---|
| Viberzi | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12390967 | Reaxys |
| CAS:864821-90-9 | KEGG DRUG |
| CAS:864821-90-9 | ChemIDplus |
| Citations |
|---|