EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H35N5O5 |
| Net Charge | 0 |
| Average Mass | 569.662 |
| Monoisotopic Mass | 569.26382 |
| SMILES | COc1ccc(CN(C(=O)[C@@H](N)Cc2c(C)cc(C(N)=O)cc2C)[C@@H](C)c2ncc(-c3ccccc3)n2)cc1C(=O)O |
| InChI | InChI=1S/C32H35N5O5/c1-18-12-23(29(34)38)13-19(2)24(18)15-26(33)31(39)37(17-21-10-11-28(42-4)25(14-21)32(40)41)20(3)30-35-16-27(36-30)22-8-6-5-7-9-22/h5-14,16,20,26H,15,17,33H2,1-4H3,(H2,34,38)(H,35,36)(H,40,41)/t20-,26-/m0/s1 |
| InChIKey | QFNHIDANIVGXPE-FNZWTVRRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. kappa-opioid receptor agonist A compound that exhibits agonist activity at the κ-opioid receptor. delta-opioid receptor antagonist Any compound that exhibits antagonist activity at the δ-opioid receptor. |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. kappa-opioid receptor agonist A compound that exhibits agonist activity at the κ-opioid receptor. delta-opioid receptor antagonist Any compound that exhibits antagonist activity at the δ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eluxadoline (CHEBI:85980) has role antispasmodic drug (CHEBI:53784) |
| eluxadoline (CHEBI:85980) has role gastrointestinal drug (CHEBI:55324) |
| eluxadoline (CHEBI:85980) has role δ-opioid receptor antagonist (CHEBI:59283) |
| eluxadoline (CHEBI:85980) has role κ-opioid receptor agonist (CHEBI:59282) |
| eluxadoline (CHEBI:85980) has role μ-opioid receptor agonist (CHEBI:55322) |
| eluxadoline (CHEBI:85980) is a L-phenylalanine derivative (CHEBI:84144) |
| eluxadoline (CHEBI:85980) is a amino acid amide (CHEBI:22475) |
| eluxadoline (CHEBI:85980) is a benzamides (CHEBI:22702) |
| eluxadoline (CHEBI:85980) is a imidazoles (CHEBI:24780) |
| eluxadoline (CHEBI:85980) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 5-({(4-carbamoyl-2,6-dimethyl-L-phenylalanyl)[(1S)-1-(4-phenyl-1H-imidazol-2-yl)ethyl]amino}methyl)-2-methoxybenzoic acid |
| INNs | Source |
|---|---|
| eluxadolina | WHO MedNet |
| eluxadoline | ChemIDplus |
| Brand Name | Source |
|---|---|
| Viberzi | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12390967 | Reaxys |
| CAS:864821-90-9 | KEGG DRUG |
| CAS:864821-90-9 | ChemIDplus |
| Citations |
|---|