EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H35F2N8O5S |
| Net Charge | +1 |
| Average Mass | 717.779 |
| Monoisotopic Mass | 717.24137 |
| SMILES | CNCC(=O)OCc1cccnc1N(C)C(=O)OC(C)[n+]1cnn(C[C@](O)(c2cc(F)ccc2F)[C@@H](C)c2nc(-c3ccc(C#N)cc3)cs2)c1 |
| InChI | InChI=1S/C35H35F2N8O5S/c1-22(33-42-30(18-51-33)25-9-7-24(15-38)8-10-25)35(48,28-14-27(36)11-12-29(28)37)19-45-21-44(20-41-45)23(2)50-34(47)43(4)32-26(6-5-13-40-32)17-49-31(46)16-39-3/h5-14,18,20-23,39,48H,16-17,19H2,1-4H3/q+1/t22-,23?,35+/m0/s1 |
| InChIKey | RSWOJTICKMKTER-QXLBVTBOSA-N |
| Roles Classification |
|---|
| Biological Roles: | ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. EC 1.14.13.70 (sterol 14alpha-demethylase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of EC 1.14.13.70 (sterol 14α-demethylase). antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isavuconazonium (CHEBI:85978) has role antifungal agent (CHEBI:35718) |
| isavuconazonium (CHEBI:85978) has role EC 1.14.13.70 (sterol 14α-demethylase) inhibitor (CHEBI:77884) |
| isavuconazonium (CHEBI:85978) has role ergosterol biosynthesis inhibitor (CHEBI:75282) |
| isavuconazonium (CHEBI:85978) has role prodrug (CHEBI:50266) |
| isavuconazonium (CHEBI:85978) is a organic cation (CHEBI:25697) |
| Incoming Relation(s) |
| isavuconazonium sulfate (CHEBI:85977) has part isavuconazonium (CHEBI:85978) |
| IUPAC Name |
|---|
| (2-{[(1-{1-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,5-difluorophenyl)-2-hydroxybutyl]-1H-1,2,4-triazol-4-ium-4-yl}ethoxy)carbonyl](methyl)amino}pyridin-3-yl)methyl N-methylglycinate |
| Synonyms | Source |
|---|---|
| BAL-8557 | ChemIDplus |
| Isavuconazonium ion | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4947 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:742049-41-8 | ChemIDplus |