EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H35F2N8O5S |
| Net Charge | +1 |
| Average Mass | 717.779 |
| Monoisotopic Mass | 717.24137 |
| SMILES | CNCC(=O)OCc1cccnc1N(C)C(=O)OC(C)[n+]1cnn(C[C@](O)(c2cc(F)ccc2F)[C@@H](C)c2nc(-c3ccc(C#N)cc3)cs2)c1 |
| InChI | InChI=1S/C35H35F2N8O5S/c1-22(33-42-30(18-51-33)25-9-7-24(15-38)8-10-25)35(48,28-14-27(36)11-12-29(28)37)19-45-21-44(20-41-45)23(2)50-34(47)43(4)32-26(6-5-13-40-32)17-49-31(46)16-39-3/h5-14,18,20-23,39,48H,16-17,19H2,1-4H3/q+1/t22-,23?,35+/m0/s1 |
| InChIKey | RSWOJTICKMKTER-QXLBVTBOSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 1.14.13.70 (sterol 14alpha-demethylase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of EC 1.14.13.70 (sterol 14α-demethylase). ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isavuconazonium (CHEBI:85978) has role antifungal agent (CHEBI:35718) |
| isavuconazonium (CHEBI:85978) has role EC 1.14.13.70 (sterol 14α-demethylase) inhibitor (CHEBI:77884) |
| isavuconazonium (CHEBI:85978) has role ergosterol biosynthesis inhibitor (CHEBI:75282) |
| isavuconazonium (CHEBI:85978) has role prodrug (CHEBI:50266) |
| isavuconazonium (CHEBI:85978) is a organic cation (CHEBI:25697) |
| Incoming Relation(s) |
| isavuconazonium sulfate (CHEBI:85977) has part isavuconazonium (CHEBI:85978) |
| IUPAC Name |
|---|
| (2-{[(1-{1-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,5-difluorophenyl)-2-hydroxybutyl]-1H-1,2,4-triazol-4-ium-4-yl}ethoxy)carbonyl](methyl)amino}pyridin-3-yl)methyl N-methylglycinate |
| Synonyms | Source |
|---|---|
| BAL-8557 | ChemIDplus |
| Isavuconazonium ion | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4947 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:742049-41-8 | ChemIDplus |