EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H25N3O16P2 |
| Net Charge | 0 |
| Average Mass | 589.340 |
| Monoisotopic Mass | 589.07100 |
| SMILES | C=C1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3ccc(=O)nc3=O)[C@H](O)[C@@H]2O)[C@H](NC(C)=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H25N3O16P2/c1-6-11(23)13(25)10(18-7(2)21)16(33-6)35-38(30,31)36-37(28,29)32-5-8-12(24)14(26)15(34-8)20-4-3-9(22)19-17(20)27/h3-4,8,10-16,23-26H,1,5H2,2H3,(H,18,21)(H,28,29)(H,30,31)(H,19,22,27)/t8-,10-,11+,12-,13-,14-,15-,16-/m1/s1 |
| InChIKey | BNDFCARCBRBJRX-KFVCKIFFSA-N |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UDP-N-acetylgalactosamine-5,6-ene (CHEBI:85964) has role bacterial metabolite (CHEBI:76969) |
| UDP-N-acetylgalactosamine-5,6-ene (CHEBI:85964) is a UDP-amino sugar (CHEBI:35262) |
| UDP-N-acetylgalactosamine-5,6-ene (CHEBI:85964) is conjugate acid of UDP-N-acetylgalactosamine-5,6-ene(2−) (CHEBI:85718) |
| Incoming Relation(s) |
| UDP-N-acetylgalactosamine-5,6-ene(2−) (CHEBI:85718) is conjugate base of UDP-N-acetylgalactosamine-5,6-ene (CHEBI:85964) |
| IUPAC Name |
|---|
| uridine 5'-[3-(2-acetamido-2,6-dideoxy-β-L-arabino-hex-5-enopyranosyl) dihydrogen diphosphate] |
| Synonyms | Source |
|---|---|
| UDP-N-acetyl-5,6-dehydrogalactosamine | ChEBI |
| UDP-N-acetyl-5,6-dehydro-α-galactosamine | ChEBI |
| UDP-N-acetyl-α-galactosamine-5,6-ene | ChEBI |
| Citations |
|---|