EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8596 - Protoverine
| Formula | C27H43NO9 |
| Net Charge | 0 |
| Average Mass | 525.639 |
| Monoisotopic Mass | 525.29378 |
| SMILES | [H][C@@]12CN3C[C@@H](C)CC[C@@]3([H])[C@@](C)(O)[C@@]1([H])[C@@H](O)[C@H](O)[C@]1(O)[C@@]2([H])C[C@]23O[C@]4(O)[C@@H](O)CC[C@@]2(C)[C@]4([H])[C@@H](O)[C@@H](O)[C@]31[H] |
| InChI | InChI=1S/C27H43NO9/c1-11-4-5-14-24(3,34)16-12(10-28(14)9-11)13-8-25-21(26(13,35)22(33)17(16)30)19(32)18(31)20-23(25,2)7-6-15(29)27(20,36)37-25/h11-22,29-36H,4-10H2,1-3H3/t11-,12-,13-,14-,15-,16+,17+,18-,19+,20-,21+,22-,23-,24+,25+,26-,27+/m0/s1 |
| InChIKey | CKJAABZFXLMMCS-MKKPLVDTSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Protoverine (CHEBI:8596) is a alkaloid (CHEBI:22315) |
| Synonyms | Source |
|---|---|
| 6alpha-Hydroxygermine | DrugCentral |
| Protoverine | KEGG COMPOUND |