EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9NO2S |
| Net Charge | 0 |
| Average Mass | 207.254 |
| Monoisotopic Mass | 207.03540 |
| SMILES | Cc1ccc(S(=O)(=O)/C=C/C#N)cc1 |
| InChI | InChI=1S/C10H9NO2S/c1-9-3-5-10(6-4-9)14(12,13)8-2-7-11/h2-6,8H,1H3/b8-2+ |
| InChIKey | DOEWDSDBFRHVAP-KRXBUXKQSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.11.10 (IkappaB kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of IκB kinase (EC 2.7.11.10). EC 3.1.3.48 (protein-tyrosine-phosphatase) inhibitor An EC 3.1.3.* (phosphoric monoester hydrolase) inhibitor which interferes with the activity of the enzyme protein tyrosine phosphatases (PTPs), EC 3.1.3.48, involved in the removal of phosphate groups from phosphorylated tyrosine residues on proteins. |
| Applications: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-3-tosylacrylonitrile (CHEBI:85928) has role apoptosis inducer (CHEBI:68495) |
| (E)-3-tosylacrylonitrile (CHEBI:85928) has role EC 2.7.11.10 (IκB kinase) inhibitor (CHEBI:77113) |
| (E)-3-tosylacrylonitrile (CHEBI:85928) has role EC 3.1.3.48 (protein-tyrosine-phosphatase) inhibitor (CHEBI:35608) |
| (E)-3-tosylacrylonitrile (CHEBI:85928) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| (E)-3-tosylacrylonitrile (CHEBI:85928) has role platelet aggregation inhibitor (CHEBI:50427) |
| (E)-3-tosylacrylonitrile (CHEBI:85928) is a nitrile (CHEBI:18379) |
| (E)-3-tosylacrylonitrile (CHEBI:85928) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| (2E)-3-[(4-methylphenyl)sulfonyl]acrylonitrile |
| Synonyms | Source |
|---|---|
| BAY-11-7082 | ChemIDplus |
| BAY-11-7821 | ChemIDplus |
| β-(cyanovinyl)-p-tolylsulfone | ChemIDplus |
| Bay-117082 | ChEBI |
| (3E)3-(p-toluenesulfonyl)acrylonitrile | ChEBI |
| (E)-3-(p-toluenesulfonyl)acrylonitrile | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2049371 | Reaxys |
| CAS:19542-67-7 | ChemIDplus |
| Citations |
|---|