EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H9O4PS |
| Net Charge | 0 |
| Average Mass | 172.142 |
| Monoisotopic Mass | 171.99592 |
| SMILES | C[C@H](O)[C@@H](S)P(=O)(O)O |
| InChI | InChI=1S/C3H9O4PS/c1-2(4)3(9)8(5,6)7/h2-4,9H,1H3,(H2,5,6,7)/t2-,3+/m0/s1 |
| InChIKey | BRHOGAASLZJGAI-STHAYSLISA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(1R,2S)-2-hydroxy-1-thiopropyl]phosphonic acid (CHEBI:85920) is a alkanethiol (CHEBI:47908) |
| [(1R,2S)-2-hydroxy-1-thiopropyl]phosphonic acid (CHEBI:85920) is a phosphonic acids (CHEBI:26069) |
| [(1R,2S)-2-hydroxy-1-thiopropyl]phosphonic acid (CHEBI:85920) is a secondary alcohol (CHEBI:35681) |
| [(1R,2S)-2-hydroxy-1-thiopropyl]phosphonic acid (CHEBI:85920) is conjugate acid of [(1R,2S)-2-hydroxy-1-thiopropyl]phosphonate(2−) (CHEBI:85579) |
| Incoming Relation(s) |
| [(1R,2S)-2-hydroxy-1-thiopropyl]phosphonate(2−) (CHEBI:85579) is conjugate base of [(1R,2S)-2-hydroxy-1-thiopropyl]phosphonic acid (CHEBI:85920) |
| IUPAC Name |
|---|
| [(1R,2S)-2-hydroxy-1-sulfanylpropyl]phosphonic acid |
| Synonym | Source |
|---|---|
| [(1R,2S)-2-hydroxy-1-mercaptopropyl]phosphonic acid | ChEBI |