EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17N3O8S2 |
| Net Charge | 0 |
| Average Mass | 371.393 |
| Monoisotopic Mass | 371.04571 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CSS(=O)O)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H17N3O8S2/c11-5(10(18)19)1-2-7(14)13-6(4-22-23(20)21)9(17)12-3-8(15)16/h5-6H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)(H,20,21)/t5-,6-/m0/s1 |
| InChIKey | QUBUTNSZZFICHL-WDSKDSINSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glutathione S-sulfinate (CHEBI:85904) is a S-substituted glutathione (CHEBI:17021) |
| glutathione S-sulfinate (CHEBI:85904) is a L-cysteine derivative (CHEBI:83824) |
| glutathione S-sulfinate (CHEBI:85904) is a tripeptide (CHEBI:47923) |
| glutathione S-sulfinate (CHEBI:85904) is conjugate acid of glutathione S-sulfinate(2−) (CHEBI:85586) |
| Incoming Relation(s) |
| glutathione S-sulfinate(2−) (CHEBI:85586) is conjugate base of glutathione S-sulfinate (CHEBI:85904) |
| IUPAC Name |
|---|
| L-γ-glutamyl-3-(sulfinosulfanyl)-L-alanylglycine |
| Synonyms | Source |
|---|---|
| S-sulfinylglutathione | ChEBI |
| glutathione S-sulfinic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-17866 | MetaCyc |