EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H33NO9 |
| Net Charge | 0 |
| Average Mass | 527.570 |
| Monoisotopic Mass | 527.21553 |
| SMILES | CC[C@@]1(O)C[C@H](O[C@H]2C[C@H](N(C)C)[C@H](O)[C@H](C)O2)c2c(cc3c(c2O)C(=O)c2c(O)cccc2C3=O)[C@H]1O |
| InChI | InChI=1S/C28H33NO9/c1-5-28(36)11-18(38-19-10-16(29(3)4)23(31)12(2)37-19)21-15(27(28)35)9-14-22(26(21)34)25(33)20-13(24(14)32)7-6-8-17(20)30/h6-9,12,16,18-19,23,27,30-31,34-36H,5,10-11H2,1-4H3/t12-,16-,18-,19-,23+,27+,28+/m0/s1 |
| InChIKey | IWALHFMBCZSCRZ-SONOWFOZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-deoxy-β-rhodomycin (CHEBI:85897) is a p-quinones (CHEBI:25830) |
| 11-deoxy-β-rhodomycin (CHEBI:85897) is a aminoglycoside (CHEBI:47779) |
| 11-deoxy-β-rhodomycin (CHEBI:85897) is a anthracycline (CHEBI:48120) |
| 11-deoxy-β-rhodomycin (CHEBI:85897) is a deoxy hexoside (CHEBI:35315) |
| 11-deoxy-β-rhodomycin (CHEBI:85897) is a monosaccharide derivative (CHEBI:63367) |
| 11-deoxy-β-rhodomycin (CHEBI:85897) is a polyphenol (CHEBI:26195) |
| 11-deoxy-β-rhodomycin (CHEBI:85897) is tautomer of 11-deoxy-β-rhodomycin zwitterion (CHEBI:85430) |
| Incoming Relation(s) |
| 11-deoxy-β-rhodomycin zwitterion (CHEBI:85430) is tautomer of 11-deoxy-β-rhodomycin (CHEBI:85897) |
| IUPAC Name |
|---|
| (1S,3R,4R)-3-ethyl-3,4,10,12-tetrahydroxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl 2,3,6-trideoxy-3-(dimethylamino)-α-L-lyxo-hexopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7786739 | Reaxys |
| Citations |
|---|