EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O3 |
| Net Charge | 0 |
| Average Mass | 188.227 |
| Monoisotopic Mass | 188.11609 |
| SMILES | CC(C)NC(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H16N2O3/c1-5(2)10-7(11)4-3-6(9)8(12)13/h5-6H,3-4,9H2,1-2H3,(H,10,11)(H,12,13)/t6-/m0/s1 |
| InChIKey | CABXGBMKSVRWOG-LURJTMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas sp. (ncbitaxon:306) | - | PubMed (11976110) | Strain: KIE171 |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-isopropyl-L-glutamine (CHEBI:85891) has role bacterial metabolite (CHEBI:76969) |
| N-isopropyl-L-glutamine (CHEBI:85891) is a N5-alkyl-L-glutamine (CHEBI:21844) |
| N-isopropyl-L-glutamine (CHEBI:85891) is tautomer of N-isopropyl-L-glutamine zwitterion (CHEBI:85420) |
| Incoming Relation(s) |
| N-isopropyl-L-glutamine zwitterion (CHEBI:85420) is tautomer of N-isopropyl-L-glutamine (CHEBI:85891) |
| IUPAC Name |
|---|
| N-propan-2-yl-L-glutamine |
| Synonyms | Source |
|---|---|
| N5-isopropyl-L-glutamine | ChEBI |
| γ-glutamyl-isopropylamide | MetaCyc |
| Citations |
|---|