EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C51H84O22 |
| Net Charge | 0 |
| Average Mass | 1049.211 |
| Monoisotopic Mass | 1048.54542 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O[C@@H]4O[C@H](CO)[C@@H](O[C@@H]5O[C@@H](C)[C@H](O)[C@@H](O)[C@H]5O)[C@H](O)[C@H]4O[C@@H]4O[C@@H](C)[C@H](O)[C@@H](O)[C@H]4O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])C[C@]2([H])O[C@](O)(CC[C@@H](C)CO[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](C)[C@]12[H] |
| InChI | InChI=1S/C51H84O22/c1-20(19-65-45-39(60)38(59)35(56)30(17-52)69-45)9-14-51(64)21(2)32-29(73-51)16-28-26-8-7-24-15-25(10-12-49(24,5)27(26)11-13-50(28,32)6)68-48-44(72-47-41(62)37(58)34(55)23(4)67-47)42(63)43(31(18-53)70-48)71-46-40(61)36(57)33(54)22(3)66-46/h7,20-23,25-48,52-64H,8-19H2,1-6H3/t20-,21+,22+,23+,25+,26-,27+,28+,29+,30-,31-,32+,33+,34+,35-,36-,37-,38+,39-,40-,41-,42+,43-,44-,45-,46+,47+,48-,49+,50+,51-/m1/s1 |
| InChIKey | LVTJOONKWUXEFR-UEZXSUPNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| protodioscin (CHEBI:8588) has parent hydride furostan (CHEBI:24130) |
| protodioscin (CHEBI:8588) has role anti-inflammatory agent (CHEBI:67079) |
| protodioscin (CHEBI:8588) has role antilipemic drug (CHEBI:35679) |
| protodioscin (CHEBI:8588) has role antineoplastic agent (CHEBI:35610) |
| protodioscin (CHEBI:8588) has role apoptosis inducer (CHEBI:68495) |
| protodioscin (CHEBI:8588) has role neuroprotective agent (CHEBI:63726) |
| protodioscin (CHEBI:8588) has role plant metabolite (CHEBI:76924) |
| protodioscin (CHEBI:8588) is a cyclic hemiketal (CHEBI:59780) |
| protodioscin (CHEBI:8588) is a pentacyclic triterpenoid (CHEBI:25872) |
| protodioscin (CHEBI:8588) is a steroid saponin (CHEBI:61655) |
| protodioscin (CHEBI:8588) is a trisaccharide derivative (CHEBI:63571) |
| protodioscin (CHEBI:8588) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (3β,22R,25R)-26-(β-D-glucopyranosyloxy)-22-hydroxyfurost-5-en-3-yl α-L-rhamnopyranosyl-(1→2)-[α-L-rhamnopyranosyl-(1→4)]-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| Protodioscin | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| protodioscin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C08907 | KEGG COMPOUND |
| Protodioscin | Wikipedia |
| HMDB0034062 | HMDB |
| C00003585 | KNApSAcK |
| FDB012730 | FooDB |
| CPD-15469 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7683115 | Reaxys |
| CAS:55056-80-9 | KEGG COMPOUND |
| Citations |
|---|