EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C51H84O22 |
| Net Charge | 0 |
| Average Mass | 1049.211 |
| Monoisotopic Mass | 1048.54542 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O[C@@H]4O[C@H](CO)[C@@H](O[C@@H]5O[C@@H](C)[C@H](O)[C@@H](O)[C@H]5O)[C@H](O)[C@H]4O[C@@H]4O[C@@H](C)[C@H](O)[C@@H](O)[C@H]4O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])C[C@]2([H])O[C@](O)(CC[C@@H](C)CO[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](C)[C@]12[H] |
| InChI | InChI=1S/C51H84O22/c1-20(19-65-45-39(60)38(59)35(56)30(17-52)69-45)9-14-51(64)21(2)32-29(73-51)16-28-26-8-7-24-15-25(10-12-49(24,5)27(26)11-13-50(28,32)6)68-48-44(72-47-41(62)37(58)34(55)23(4)67-47)42(63)43(31(18-53)70-48)71-46-40(61)36(57)33(54)22(3)66-46/h7,20-23,25-48,52-64H,8-19H2,1-6H3/t20-,21+,22+,23+,25+,26-,27+,28+,29+,30-,31-,32+,33+,34+,35-,36-,37-,38+,39-,40-,41-,42+,43-,44-,45-,46+,47+,48-,49+,50+,51-/m1/s1 |
| InChIKey | LVTJOONKWUXEFR-UEZXSUPNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| protodioscin (CHEBI:8588) has parent hydride furostan (CHEBI:24130) |
| protodioscin (CHEBI:8588) has role anti-inflammatory agent (CHEBI:67079) |
| protodioscin (CHEBI:8588) has role antilipemic drug (CHEBI:35679) |
| protodioscin (CHEBI:8588) has role antineoplastic agent (CHEBI:35610) |
| protodioscin (CHEBI:8588) has role apoptosis inducer (CHEBI:68495) |
| protodioscin (CHEBI:8588) has role neuroprotective agent (CHEBI:63726) |
| protodioscin (CHEBI:8588) has role plant metabolite (CHEBI:76924) |
| protodioscin (CHEBI:8588) is a cyclic hemiketal (CHEBI:59780) |
| protodioscin (CHEBI:8588) is a pentacyclic triterpenoid (CHEBI:25872) |
| protodioscin (CHEBI:8588) is a steroid saponin (CHEBI:61655) |
| protodioscin (CHEBI:8588) is a trisaccharide derivative (CHEBI:63571) |
| protodioscin (CHEBI:8588) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (3β,22R,25R)-26-(β-D-glucopyranosyloxy)-22-hydroxyfurost-5-en-3-yl α-L-rhamnopyranosyl-(1→2)-[α-L-rhamnopyranosyl-(1→4)]-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| Protodioscin | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| protodioscin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003585 | KNApSAcK |
| C08907 | KEGG COMPOUND |
| CPD-15469 | MetaCyc |
| FDB012730 | FooDB |
| HMDB0034062 | HMDB |
| Protodioscin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7683115 | Reaxys |
| CAS:55056-80-9 | KEGG COMPOUND |
| Citations |
|---|