EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16N6O3 |
| Net Charge | 0 |
| Average Mass | 316.321 |
| Monoisotopic Mass | 316.12839 |
| SMILES | Nc1nc2c(c(=O)n1)N[C@@H](CNc1ccc(C(=O)O)cc1)CN2 |
| InChI | InChI=1S/C14H16N6O3/c15-14-19-11-10(12(21)20-14)18-9(6-17-11)5-16-8-3-1-7(2-4-8)13(22)23/h1-4,9,16,18H,5-6H2,(H,22,23)(H4,15,17,19,20,21)/t9-/m0/s1 |
| InChIKey | OXIZGFYJYJOABB-VIFPVBQESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (6S)-5,6,7,8-tetrahydropteroic acid (CHEBI:85811) is a pteroic acids (CHEBI:38795) |
| (6S)-5,6,7,8-tetrahydropteroic acid (CHEBI:85811) is conjugate acid of (6S)-5,6,7,8-tetrahydropteroate (CHEBI:85414) |
| Incoming Relation(s) |
| (6S)-5,6,7,8-tetrahydropteroate (CHEBI:85414) is conjugate base of (6S)-5,6,7,8-tetrahydropteroic acid (CHEBI:85811) |
| IUPAC Name |
|---|
| 4-({[(6S)-2-amino-4-oxo-1,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-9020 | MetaCyc |