EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5ClO4 |
| Net Charge | 0 |
| Average Mass | 176.555 |
| Monoisotopic Mass | 175.98764 |
| SMILES | O=C(O)C[C@@]1(Cl)C=CC(=O)O1 |
| InChI | InChI=1S/C6H5ClO4/c7-6(3-4(8)9)2-1-5(10)11-6/h1-2H,3H2,(H,8,9)/t6-/m1/s1 |
| InChIKey | WGZZDRVKIXVYEI-ZCFIWIBFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas sp. P51 (ncbitaxon:65067) | - | PubMed (12930985) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-(2-chloro-5-oxo-2,5-dihydro-2-furyl)acetic acid (CHEBI:85800) has role bacterial metabolite (CHEBI:76969) |
| (R)-(2-chloro-5-oxo-2,5-dihydro-2-furyl)acetic acid (CHEBI:85800) is a (2-chloro-5-oxo-2,5-dihydro-2-furyl)acetic acid (CHEBI:17337) |
| (R)-(2-chloro-5-oxo-2,5-dihydro-2-furyl)acetic acid (CHEBI:85800) is conjugate acid of (R)-(2-chloro-5-oxo-2,5-dihydro-2-furyl)acetate (CHEBI:85538) |
| Incoming Relation(s) |
| (R)-(2-chloro-5-oxo-2,5-dihydro-2-furyl)acetate (CHEBI:85538) is conjugate base of (R)-(2-chloro-5-oxo-2,5-dihydro-2-furyl)acetic acid (CHEBI:85800) |
| IUPAC Name |
|---|
| [(2R)-2-chloro-5-oxo-2,5-dihydrofuran-2-yl]acetic acid |
| Synonym | Source |
|---|---|
| (+)-4-chloromuconolactone | ChEBI |
| Citations |
|---|