EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O3 |
| Net Charge | 0 |
| Average Mass | 418.662 |
| Monoisotopic Mass | 418.34470 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCCC(C)C)[C@]1([H])[C@H](O)C=C1[C@@H](O)[C@@H](O)CC[C@@]12C |
| InChI | InChI=1S/C27H46O3/c1-16(2)7-6-8-17(3)18-9-10-19-24-20(11-13-26(18,19)4)27(5)14-12-22(28)25(30)21(27)15-23(24)29/h15-20,22-25,28-30H,6-14H2,1-5H3/t17-,18-,19+,20+,22+,23-,24+,25-,26-,27-/m1/s1 |
| InChIKey | NEITZYUKMAAGFE-DNPWHXEXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (12077124) |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4β,7α-dihydroxycholesterol (CHEBI:85779) has role human xenobiotic metabolite (CHEBI:76967) |
| 4β,7α-dihydroxycholesterol (CHEBI:85779) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| 4β,7α-dihydroxycholesterol (CHEBI:85779) is a 3β-sterol (CHEBI:35348) |
| 4β,7α-dihydroxycholesterol (CHEBI:85779) is a 4-hydroxy steroid (CHEBI:62846) |
| 4β,7α-dihydroxycholesterol (CHEBI:85779) is a 7α-hydroxy steroid (CHEBI:36843) |
| 4β,7α-dihydroxycholesterol (CHEBI:85779) is a oxysterol (CHEBI:53030) |
| 4β,7α-dihydroxycholesterol (CHEBI:85779) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| cholest-5-en-3β,4β,7α-triol |
| Synonym | Source |
|---|---|
| (3β,4β,7α)-cholest-5-ene-3,4,7-triol | IUPAC |
| UniProt Name | Source |
|---|---|
| 4β,7α-dihydroxycholesterol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3220537 | Reaxys |
| Citations |
|---|