EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C54H47N13O12S6 |
| Net Charge | 0 |
| Average Mass | 1262.451 |
| Monoisotopic Mass | 1261.17914 |
| SMILES | C=C(NC(=O)C(=C)NC(=O)c1csc(-c2ccc3c(n2)-c2csc(n2)[C@H](CSC(=O)c2nc4cccc(C)c4c2C)NC(=O)c2csc(n2)[C@H](CCC(=O)O)NC(=O)c2cnc(s2)/C(=C/C)NC(=O)[C@H]([C@@H](C)O)NC(=O)c2csc-3n2)n1)C(=O)O |
| InChI | InChI=1S/C54H47N13O12S6/c1-7-27-49-55-15-36(85-49)46(75)61-30(13-14-37(69)70)51-66-33(19-83-51)44(73)62-35(20-84-54(79)39-22(3)38-21(2)9-8-10-28(38)58-39)52-63-31(16-81-52)41-26(48-64-34(17-80-48)45(74)67-40(25(6)68)47(76)60-27)11-12-29(59-41)50-65-32(18-82-50)43(72)56-23(4)42(71)57-24(5)53(77)78/h7-12,15-19,25,30,35,40,58,68H,4-5,13-14,20H2,1-3,6H3,(H,56,72)(H,57,71)(H,60,76)(H,61,75)(H,62,73)(H,67,74)(H,69,70)(H,77,78)/b27-7-/t25-,30+,35+,40+/m1/s1 |
| InChIKey | VXILBHDITLWEOK-JTESZQDOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces actuosus (ncbitaxon:1885) | - | PubMed (19678698) | Strain: ATCC 25421 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dimethylindolyl precursor of nosiheptide (CHEBI:85714) has role bacterial metabolite (CHEBI:76969) |
| 3,4-dimethylindolyl precursor of nosiheptide (CHEBI:85714) is a azamacrocycle (CHEBI:52898) |
| 3,4-dimethylindolyl precursor of nosiheptide (CHEBI:85714) is a heterodetic cyclic peptide (CHEBI:24533) |
| 3,4-dimethylindolyl precursor of nosiheptide (CHEBI:85714) is a ring assembly (CHEBI:36820) |
| Citations |
|---|