EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H25N3O9S3.2Na |
| Net Charge | 0 |
| Average Mass | 737.745 |
| Monoisotopic Mass | 737.05483 |
| SMILES | [H][N+](=C1C=CC(=C(c2ccc(Nc3ccc(S(=O)(=O)[O-])cc3)cc2)c2cc(C)c(N)c(S(=O)(=O)[O-])c2)C=C1)c1ccc(S(=O)(=O)[O-])cc1.[Na+].[Na+] |
| InChI | InChI=1S/C32H27N3O9S3.2Na/c1-20-18-23(19-30(32(20)33)47(42,43)44)31(21-2-6-24(7-3-21)34-26-10-14-28(15-11-26)45(36,37)38)22-4-8-25(9-5-22)35-27-12-16-29(17-13-27)46(39,40)41;;/h2-19,34H,33H2,1H3,(H,36,37,38)(H,39,40,41)(H,42,43,44);;/q;2*+1/p-2/b31-22-,35-25+;; |
| InChIKey | XOSXWYQMOYSSKB-LDKJGXKFSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| water blue (CHEBI:85681) has part NSC 56820(2−) (CHEBI:86250) |
| water blue (CHEBI:85681) has role histological dye (CHEBI:77178) |
| water blue (CHEBI:85681) is a organic sodium salt (CHEBI:38700) |
| Incoming Relation(s) |
| aniline blue WS (CHEBI:87471) has part water blue (CHEBI:85681) |
| IUPAC Name |
|---|
| disodium 2-amino-3-methyl-5-({4-[(4-sulfonatophenyl)amino]phenyl}{4-[(4-sulfonatophenyl)iminio]cyclohexa-2,5-dien-1-ylidene}methyl)benzenesulfonate |
| Synonyms | Source |
|---|---|
| Acid Blue 22 | ChemIDplus |
| Aniline Blue | ChemIDplus |
| C.I. 42755 | ChemIDplus |
| C.I. Acid Blue 22 | ChemIDplus |
| Cotton blue | ChemIDplus |
| Marine Blue V | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Water_blue | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9249268 | Reaxys |
| CAS:28631-66-5 | ChemIDplus |
| Citations |
|---|