EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H45O5 |
| Net Charge | -1 |
| Average Mass | 449.652 |
| Monoisotopic Mass | 449.32725 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])C[C@H](O)[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCCC(C)C(=O)[O-])[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C27H46O5/c1-15(6-5-7-16(2)25(31)32)19-8-9-20-24-21(14-23(30)27(19,20)4)26(3)11-10-18(28)12-17(26)13-22(24)29/h15-24,28-30H,5-14H2,1-4H3,(H,31,32)/p-1/t15-,16?,17+,18-,19-,20+,21+,22-,23+,24+,26+,27-/m1/s1 |
| InChIKey | CNWPIIOQKZNXBB-VCVMUKOKSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3α,7α,12α-trihydroxy-5β-cholestan-26-oate(1−) (CHEBI:85674) is a monocarboxylic acid anion (CHEBI:35757) |
| 3α,7α,12α-trihydroxy-5β-cholestan-26-oate(1−) (CHEBI:85674) is conjugate base of 3α,7α,12α-trihydroxy-5β-cholestan-26-oic acid (CHEBI:18402) |
| Incoming Relation(s) |
| 3α,7α,12α-trihydroxy-5β-cholestan-26-oic acid (CHEBI:18402) is conjugate acid of 3α,7α,12α-trihydroxy-5β-cholestan-26-oate(1−) (CHEBI:85674) |
| IUPAC Name |
|---|
| 3α,7α,12α-trihydroxy-5β-cholestan-26-oate |
| Synonyms | Source |
|---|---|
| 3α,7α,12α-trihydroxy-5β-cholestanoate(1−) | SUBMITTER |
| 3α,7α,12α-trihydroxy-5β-cholestanoate | KEGG COMPOUND |
| 3α,7α,12α-trihydroxy-5β-cholestanate | KEGG COMPOUND |
| 3α,7α,12α-trihydroxy-5β-cholestan-26-oate | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 3α,7α,12α-trihydroxy-5β-cholestan-26-oate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C04722 | KEGG COMPOUND |
| HMDB0000601 | HMDB |
| LMST04030001 | LIPID MAPS |
| Citations |
|---|