EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H38N4O6 |
| Net Charge | 0 |
| Average Mass | 586.689 |
| Monoisotopic Mass | 586.27913 |
| SMILES | [H][C@]1(Cc2nc(/C=C3\N=C(/C=C4\NC(=O)[C@H](C)\C4=C/C)C(C)=C3CCC(=O)O)c(CCC(=O)O)c2C)NC(=O)C(C=C)=C1C |
| InChI | InChI=1S/C33H38N4O6/c1-7-20-19(6)32(42)37-27(20)14-25-18(5)23(10-12-31(40)41)29(35-25)15-28-22(9-11-30(38)39)17(4)24(34-28)13-26-16(3)21(8-2)33(43)36-26/h7-8,14-15,19,26,34H,2,9-13H2,1,3-6H3,(H,36,43)(H,37,42)(H,38,39)(H,40,41)/b20-7+,27-14-,29-15-/t19-,26-/m1/s1 |
| InChIKey | CNEWLWMGPFUJPG-JCEXRVCVSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3E)-phycoerythrobilin (CHEBI:85659) is a phycoerythrobilin (CHEBI:36741) |
| (3E)-phycoerythrobilin (CHEBI:85659) is conjugate acid of (3E)-phycoerythrobilin(2−) (CHEBI:85276) |
| Incoming Relation(s) |
| (3E)-phycoerythrobilin(2−) (CHEBI:85276) is conjugate base of (3E)-phycoerythrobilin (CHEBI:85659) |
| Synonym | Source |
|---|---|
| Phycoerythrobilin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CPD-17223 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:18097-67-1 | ChemIDplus |