EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21F3N2O3 |
| Net Charge | 0 |
| Average Mass | 346.349 |
| Monoisotopic Mass | 346.15043 |
| SMILES | Cc1ccc(C(=O)NC[C@@H](NC(=O)OCC(F)(F)F)C(C)C)cc1 |
| InChI | InChI=1S/C16H21F3N2O3/c1-10(2)13(21-15(23)24-9-16(17,18)19)8-20-14(22)12-6-4-11(3)5-7-12/h4-7,10,13H,8-9H2,1-3H3,(H,20,22)(H,21,23)/t13-/m1/s1 |
| InChIKey | RSOBJVBYZCMJOS-CYBMUJFWSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tolprocarb (CHEBI:85628) has role antifungal agrochemical (CHEBI:86328) |
| tolprocarb (CHEBI:85628) is a benzamides (CHEBI:22702) |
| tolprocarb (CHEBI:85628) is a carbamate ester (CHEBI:23003) |
| tolprocarb (CHEBI:85628) is a carbamate fungicide (CHEBI:87061) |
| tolprocarb (CHEBI:85628) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 2,2,2-trifluoroethyl [(2S)-3-methyl-1-(4-methylbenzamido)butan-2-yl]carbamate |
| Synonyms | Source |
|---|---|
| 2,2,2-trifluoroethyl N-[(1S)-2-methyl-1-[[(4-methylbenzoyl)amino]methyl]propyl]carbamate | Alan Wood's Pesticides |
| 2,2,2-trifluoroethyl (S)-[2-methyl-1-(p-toluoylaminomethyl)propyl]carbamate | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| 3080 | PPDB |
| tolprocarb | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11342132 | Reaxys |
| CAS:911499-62-2 | Alan Wood's Pesticides |