EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H31NO10 |
| Net Charge | 0 |
| Average Mass | 565.575 |
| Monoisotopic Mass | 565.19480 |
| SMILES | COc1cc(O)c2c(O)c3c(c4c2c1[C@]1(C4)C(C)=CCCC1(C)C)[C@H](O)[C@@]1(O)CC(O)=C(C(N)=O)C(=O)[C@@]1(O)C3=O |
| InChI | InChI=1S/C30H31NO10/c1-11-6-5-7-27(2,3)28(11)9-12-16-18(13(32)8-15(41-4)21(16)28)22(34)20-17(12)23(35)29(39)10-14(33)19(26(31)38)24(36)30(29,40)25(20)37/h6,8,23,32-35,39-40H,5,7,9-10H2,1-4H3,(H2,31,38)/t23-,28-,29-,30+/m0/s1 |
| InChIKey | SUWQGLGDFGHZNH-WBWZXODPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus ustus (ncbitaxon:40382) | - | PubMed (25706180) | |
| Penicillium aethiopicum (ncbitaxon:36650) | - | PubMed (22590971) | |
| Penicillium brasilianum (ncbitaxon:104259) | - | PubMed (23168407) | Strain: FKI-3368 |
| Roles Classification |
|---|
| Biological Roles: | EC 2.5.1.31 {ditrans,polycis-undecaprenyl-diphosphate synthase [(2E,6E)-farnesyl-diphosphate specific]} inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of ditrans,polycis-undecaprenyl-diphosphate synthase [(2E,6E)-farnesyl-diphosphate specific]. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| viridicatumtoxin (CHEBI:85616) has role antimicrobial agent (CHEBI:33281) |
| viridicatumtoxin (CHEBI:85616) has role antineoplastic agent (CHEBI:35610) |
| viridicatumtoxin (CHEBI:85616) has role EC 2.5.1.31 {ditrans,polycis-undecaprenyl-diphosphate synthase [(2E,6E)-farnesyl-diphosphate specific]} inhibitor (CHEBI:85618) |
| viridicatumtoxin (CHEBI:85616) has role fungal metabolite (CHEBI:76946) |
| viridicatumtoxin (CHEBI:85616) is a aromatic ether (CHEBI:35618) |
| viridicatumtoxin (CHEBI:85616) is a aromatic ketone (CHEBI:76224) |
| viridicatumtoxin (CHEBI:85616) is a cyclic ketone (CHEBI:3992) |
| viridicatumtoxin (CHEBI:85616) is a enamide (CHEBI:51751) |
| viridicatumtoxin (CHEBI:85616) is a enol (CHEBI:33823) |
| viridicatumtoxin (CHEBI:85616) is a enone (CHEBI:51689) |
| viridicatumtoxin (CHEBI:85616) is a organic polycyclic compound (CHEBI:51958) |
| viridicatumtoxin (CHEBI:85616) is a polyketide (CHEBI:26188) |
| viridicatumtoxin (CHEBI:85616) is a polyphenol (CHEBI:26195) |
| viridicatumtoxin (CHEBI:85616) is a primary carboxamide (CHEBI:140324) |
| viridicatumtoxin (CHEBI:85616) is a secondary alcohol (CHEBI:35681) |
| viridicatumtoxin (CHEBI:85616) is a spiro compound (CHEBI:33599) |
| viridicatumtoxin (CHEBI:85616) is a tertiary alcohol (CHEBI:26878) |
| viridicatumtoxin (CHEBI:85616) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| (1S,7a'S,11a'S,12'S)-5',6',7a',10',11a',12'-hexahydroxy-3'-methoxy-2,6,6-trimethyl-7',8'-dioxo-7',7a',8',11',11a',12'-hexahydro-1'H-spiro[cyclohex-2-ene-1,2'-cyclopenta[de]tetracene]-9'-carboxamide |
| Synonyms | Source |
|---|---|
| NSC 159628 | ChemIDplus |
| SC 28762 | ChemIDplus |
| viridicatumtoxin A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2934660 | Reaxys |
| CAS:39277-41-3 | ChemIDplus |
| Citations |
|---|