EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H50Cl2N10Pt3 |
| Net Charge | +4 |
| Average Mass | 990.742 |
| Monoisotopic Mass | 989.25188 |
| SMILES | [NH3+][Pt-2]([NH3+])([Cl])[NH2+]CCCCCC[NH2+][Pt-2]([NH3+])([NH3+])[NH2+]CCCCCC[NH2+][Pt-2]([NH3+])([NH3+])[Cl] |
| InChI | InChI=1S/2C6H16N2.2ClH.6H3N.3Pt/c2*7-5-3-1-2-4-6-8;;;;;;;;;;;/h2*1-8H2;2*1H;6*1H3;;;/q;;;;;;;;;;3*+2/p-2 |
| InChIKey | BLYVBOMCZVHBIS-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triplatin(4+) (CHEBI:85612) has role antineoplastic agent (CHEBI:35610) |
| triplatin(4+) (CHEBI:85612) is a organic cation (CHEBI:25697) |
| triplatin(4+) (CHEBI:85612) is a platinum coordination entity (CHEBI:33862) |
| Incoming Relation(s) |
| triplatin tetranitrate (CHEBI:85611) has part triplatin(4+) (CHEBI:85612) |
| Synonyms | Source |
|---|---|
| Triplatin cation | ChemIDplus |
| trans-(bis(trans-Diaminechloroplatinum(1,6-hexanediamine)))diamine-platinum | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:16213506 | Reaxys |
| CAS:172902-99-7 | ChemIDplus |