EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H18Cl2N2O2Pt |
| Net Charge | 0 |
| Average Mass | 416.206 |
| Monoisotopic Mass | 415.03932 |
| SMILES | [NH3+][Pt-2]([OH])([OH])([Cl])([Cl])[NH2+]C1CCCCC1 |
| InChI | InChI=1S/C6H13N.2ClH.H3N.2H2O.Pt/c7-6-4-2-1-3-5-6;;;;;;/h6H,1-5,7H2;2*1H;1H3;2*1H2;/q;;;;;;+4/p-4 |
| InChIKey | DXMDDRBCDJLJCA-UHFFFAOYSA-J |
| Roles Classification |
|---|
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JM335 (CHEBI:85610) has role antineoplastic agent (CHEBI:35610) |
| JM335 (CHEBI:85610) has role apoptosis inducer (CHEBI:68495) |
| JM335 (CHEBI:85610) is a platinum coordination entity (CHEBI:33862) |
| IUPAC Name |
|---|
| ammine(dichloro)(cyclohexanamine)(dihydroxy)platinum |
| Synonyms | Source |
|---|---|
| ammine(cyclohexylamine)dihydroxodichloroplatinum(IV) | ChEBI |
| JM 335 | ChEBI |
| JM-335 | ChEBI |
| Citations |
|---|