EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H22Cl2N2O4Pt |
| Net Charge | 0 |
| Average Mass | 500.280 |
| Monoisotopic Mass | 499.06045 |
| SMILES | CC(=O)[O][Pt-2]([NH3+])([Cl])([Cl])([NH2+]C1CCCCC1)[O]C(C)=O |
| InChI | InChI=1S/C6H13N.2C2H4O2.2ClH.H3N.Pt/c7-6-4-2-1-3-5-6;2*1-2(3)4;;;;/h6H,1-5,7H2;2*1H3,(H,3,4);2*1H;1H3;/q;;;;;;+4/p-4 |
| InChIKey | CKNPWBAXEKSCRG-UHFFFAOYSA-J |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| satraplatin (CHEBI:85609) has role antineoplastic agent (CHEBI:35610) |
| satraplatin (CHEBI:85609) is a platinum coordination entity (CHEBI:33862) |
| IUPAC Name |
|---|
| bis(acetato-κO)(ammine)dichloro(cyclohexanamine)platinum |
| INN | Source |
|---|---|
| satraplatin | KEGG DRUG |
| Synonyms | Source |
|---|---|
| JM216 | ChemIDplus |
| BMY-45594 | ChemIDplus |
| BMY 45594 | ChemIDplus |
| Bis-acetatoamminedichlorocyclohexylamine platinum(IV) | ChemIDplus |
| JM-216 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D05807 | KEGG DRUG |
| Satraplatin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22320762 | Reaxys |
| CAS:129580-63-8 | ChemIDplus |
| Citations |
|---|