EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14Cl4N2Pt |
| Net Charge | 0 |
| Average Mass | 451.082 |
| Monoisotopic Mass | 448.95590 |
| SMILES | [H][N+]1([H])[C@@H]2CCCC[C@H]2[N+]([H])([H])[Pt-2]1([Cl])([Cl])([Cl])[Cl] |
| InChI | InChI=1S/C6H14N2.4ClH.Pt/c7-5-3-1-2-4-6(5)8;;;;;/h5-6H,1-4,7-8H2;4*1H;/q;;;;;+4/p-4/t5-,6-;;;;;/m1...../s1 |
| InChIKey | VPOCYEOOFRNHNL-RQDPQJJXSA-J |
| Roles Classification |
|---|
| Biological Role: | neurotoxin A poison that interferes with the functions of the nervous system. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dexormaplatin (CHEBI:85605) has role antineoplastic agent (CHEBI:35610) |
| dexormaplatin (CHEBI:85605) has role neurotoxin (CHEBI:50910) |
| dexormaplatin (CHEBI:85605) is a tetrachloro(cyclohexane-1,2-diamine-κ2N,N')platinum (CHEBI:85604) |
| IUPAC Name |
|---|
| tetrachloro[(1R,2R)-cyclohexane-1,2-diamine-κ2N,N']platinum |
| INN | Source |
|---|---|
| dexormaplatin | ChemIDplus |
| Synonyms | Source |
|---|---|
| (1R,2R)-ormaplatin | ChEBI |
| (+)-trans-Tetrachloro(1,2-cyclohexanediamine)platinum | ChemIDplus |
| U-78,938 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CN101081206 | Patent |
| CN101273964 | Patent |
| CN101283978 | Patent |
| D03723 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13498176 | Reaxys |
| CAS:96392-96-0 | ChemIDplus |