EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O4 |
| Net Charge | 0 |
| Average Mass | 314.466 |
| Monoisotopic Mass | 314.24571 |
| SMILES | CCCCCCCCC(/C=C/CCCCCCC(=O)O)OO |
| InChI | InChI=1S/C18H34O4/c1-2-3-4-5-8-11-14-17(22-21)15-12-9-6-7-10-13-16-18(19)20/h12,15,17,21H,2-11,13-14,16H2,1H3,(H,19,20)/b15-12+ |
| InChIKey | HTIQDCPWTUODDW-NTCAYCPXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-hydroperoxy-8E-octadecenoic acid (CHEBI:85589) has functional parent oleic acid (CHEBI:16196) |
| 10-hydroperoxy-8E-octadecenoic acid (CHEBI:85589) is a hydroperoxyoctadecenoic acid (CHEBI:134613) |
| 10-hydroperoxy-8E-octadecenoic acid (CHEBI:85589) is conjugate acid of 10-hydroperoxy-8E-octadecenoate (CHEBI:77755) |
| Incoming Relation(s) |
| 10-hydroperoxy-8E-octadecenoate (CHEBI:77755) is conjugate base of 10-hydroperoxy-8E-octadecenoic acid (CHEBI:85589) |
| IUPAC Name |
|---|
| (8E)-10-hydroperoxyoctadec-8-enoic acid |
| Synonyms | Source |
|---|---|
| 10-HpOME | ChEBI |
| trans-10-hydroperoxyoctadec-8-enoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5022629 | Reaxys |
| Citations |
|---|