EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H31N5O4 |
| Net Charge | 0 |
| Average Mass | 465.554 |
| Monoisotopic Mass | 465.23760 |
| SMILES | COc1ccc(-c2ccc3c(N4CCOCC4)nc(N4C[C@@H](C)O[C@@H](C)C4)nc3n2)cc1CO |
| InChI | InChI=1S/C25H31N5O4/c1-16-13-30(14-17(2)34-16)25-27-23-20(24(28-25)29-8-10-33-11-9-29)5-6-21(26-23)18-4-7-22(32-3)19(12-18)15-31/h4-7,12,16-17,31H,8-11,13-15H2,1-3H3/t16-,17+ |
| InChIKey | RFSMUFRPPYDYRD-CALCHBBNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | mTOR inhibitor A protein kinase inhibitor of the mammalian target of rapamycin (mTOR), a protein that regulates cell growth, cell proliferation, cell motility, cell survival, protein synthesis and transcription. mTOR inhibitors are used to prevent transplant rejection and in treatment of cancer. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ku-0063794 (CHEBI:85572) has role antineoplastic agent (CHEBI:35610) |
| Ku-0063794 (CHEBI:85572) has role mTOR inhibitor (CHEBI:68481) |
| Ku-0063794 (CHEBI:85572) is a benzyl alcohols (CHEBI:22743) |
| Ku-0063794 (CHEBI:85572) is a monomethoxybenzene (CHEBI:25235) |
| Ku-0063794 (CHEBI:85572) is a morpholines (CHEBI:38785) |
| Ku-0063794 (CHEBI:85572) is a pyridopyrimidine (CHEBI:38932) |
| Ku-0063794 (CHEBI:85572) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (5-{2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-(morpholin-4-yl)pyrido[2,3-d]pyrimidin-7-yl}-2-methoxyphenyl)methanol |
| Synonyms | Source |
|---|---|
| KU0063794 | ChemIDplus |
| KU-63794 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-5754 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12909210 | Reaxys |
| CAS:938440-64-3 | ChemIDplus |
| Citations |
|---|