EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O4 |
| Net Charge | 0 |
| Average Mass | 334.456 |
| Monoisotopic Mass | 334.21441 |
| SMILES | CCCCCC(=O)/C=C/[C@H]1C=CC(=O)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C20H30O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h12-16,18H,2-11H2,1H3,(H,23,24)/b14-12+/t16-,18+/m0/s1 |
| InChIKey | YKXHFAJZOFTAOC-DTXSUPOZSA-N |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-dehydroprostaglandin A1 (CHEBI:85552) has functional parent prostaglandin A1 (CHEBI:15545) |
| 15-dehydroprostaglandin A1 (CHEBI:85552) has role Escherichia coli metabolite (CHEBI:76971) |
| 15-dehydroprostaglandin A1 (CHEBI:85552) has role human metabolite (CHEBI:77746) |
| 15-dehydroprostaglandin A1 (CHEBI:85552) is a prostaglandins A (CHEBI:26334) |
| 15-dehydroprostaglandin A1 (CHEBI:85552) is conjugate acid of 15-dehydroprostaglandin A1(1−) (CHEBI:85072) |
| Incoming Relation(s) |
| 15-dehydroprostaglandin A1(1−) (CHEBI:85072) is conjugate base of 15-dehydroprostaglandin A1 (CHEBI:85552) |
| IUPAC Name |
|---|
| (13E)-9,15-dioxoprosta-10,13-dien-1-oic acid |
| Citations |
|---|