EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13NO3 |
| Net Charge | 0 |
| Average Mass | 159.185 |
| Monoisotopic Mass | 159.08954 |
| SMILES | C[N+]1(C)C[C@H](O)C[C@@H]1C(=O)[O-] |
| InChI | InChI=1S/C7H13NO3/c1-8(2)4-5(9)3-6(8)7(10)11/h5-6,9H,3-4H2,1-2H3/t5-,6-/m1/s1 |
| InChIKey | MUNWAHDYFVYIKH-PHDIDXHHSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-4-hydroxy-D-proline betaine (CHEBI:85534) has role plant metabolite (CHEBI:76924) |
| cis-4-hydroxy-D-proline betaine (CHEBI:85534) is a amino-acid betaine (CHEBI:22860) |
| cis-4-hydroxy-D-proline betaine (CHEBI:85534) is a pyrrolidine alkaloid (CHEBI:26456) |
| cis-4-hydroxy-D-proline betaine (CHEBI:85534) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (2R,4R)-4-hydroxy-1,1-dimethylpyrrolidinium-2-carboxylate |
| Synonyms | Source |
|---|---|
| (+)-turicine | ChemIDplus |
| turicine | ChemIDplus |
| UniProt Name | Source |
|---|---|
| cis-4-hydroxy-D-proline betaine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029409 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4136403 | Reaxys |
| CAS:515-24-2 | ChemIDplus |
| Citations |
|---|