EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:85532 - D-galactaro-1,4-lactone
| Formula | C6H8O7 |
| Net Charge | 0 |
| Average Mass | 192.123 |
| Monoisotopic Mass | 192.02700 |
| SMILES | [H][C@@]1([C@H](O)C(=O)O)OC(=O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H8O7/c7-1-2(8)6(12)13-4(1)3(9)5(10)11/h1-4,7-9H,(H,10,11)/t1-,2-,3+,4-/m1/s1 |
| InChIKey | XECPAIJNBXCOBO-LKELSTGYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-galactaro-1,4-lactone (CHEBI:85532) has functional parent D-galactono-1,4-lactone (CHEBI:15895) |
| D-galactaro-1,4-lactone (CHEBI:85532) is a aldarolactone (CHEBI:37426) |
| D-galactaro-1,4-lactone (CHEBI:85532) is a δ-lactone (CHEBI:18946) |
| D-galactaro-1,4-lactone (CHEBI:85532) is conjugate acid of D-galactaro-1,4-lactone(1−) (CHEBI:85317) |
| Incoming Relation(s) |
| D-galactaro-1,4-lactone(1−) (CHEBI:85317) is conjugate base of D-galactaro-1,4-lactone (CHEBI:85532) |
| IUPAC Name |
|---|
| (2S)-[(2R,3R,4R)-3,4-dihydroxy-5-oxotetrahydrofuran-2-yl](hydroxy)acetic acid |
| Citations |
|---|