EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H19NO6 |
| Net Charge | 0 |
| Average Mass | 273.285 |
| Monoisotopic Mass | 273.12124 |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)[O-])OC(=O)/C=C/CC(=O)O |
| InChI | InChI=1S/C12H19NO6/c1-13(2,3)8-9(7-11(16)17)19-12(18)6-4-5-10(14)15/h4,6,9H,5,7-8H2,1-3H3,(H-,14,15,16,17)/b6-4+/t9-/m1/s1 |
| InChIKey | JXVUHLILXGZLFR-OTQAPUNGSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-glutaconyl-L-carnitine (CHEBI:85518) is a O-acyl-L-carnitine (CHEBI:75659) |
| O-glutaconyl-L-carnitine (CHEBI:85518) is a O-glutaconylcarnitine (CHEBI:86081) |
| IUPAC Name |
|---|
| (3R)-3-{[(2E)-4-carboxybut-2-enoyl]oxy}-4-(trimethylazaniumyl)butanoate |
| Synonym | Source |
|---|---|
| (R)-glutaconylcarnitine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013129 | HMDB |