EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H24O3 |
| Net Charge | 0 |
| Average Mass | 216.321 |
| Monoisotopic Mass | 216.17254 |
| SMILES | CCCCCC(O)CCCCCC(=O)O |
| InChI | InChI=1S/C12H24O3/c1-2-3-5-8-11(13)9-6-4-7-10-12(14)15/h11,13H,2-10H2,1H3,(H,14,15) |
| InChIKey | BNWKMHUFFKDAMV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-hydroxylauric acid (CHEBI:85510) has functional parent dodecanoic acid (CHEBI:30805) |
| 7-hydroxylauric acid (CHEBI:85510) is a hydroxy fatty acid (CHEBI:24654) |
| 7-hydroxylauric acid (CHEBI:85510) is a medium-chain fatty acid (CHEBI:59554) |
| 7-hydroxylauric acid (CHEBI:85510) is conjugate acid of 7-hydroxylaurate (CHEBI:84921) |
| Incoming Relation(s) |
| 7-hydroxylaurate (CHEBI:84921) is conjugate base of 7-hydroxylauric acid (CHEBI:85510) |
| IUPAC Name |
|---|
| 7-hydroxydodecanoic acid |
| Synonym | Source |
|---|---|
| 7-hydroxy-dodecanoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| CPD-17637 | MetaCyc |
| LMFA01050166 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6767331 | Reaxys |