EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H52N7O17P3S |
| Net Charge | 0 |
| Average Mass | 907.767 |
| Monoisotopic Mass | 907.23532 |
| SMILES | CC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C30H52N7O17P3S/c1-17(2)7-6-8-18(3)29(42)58-12-11-32-20(38)9-10-33-27(41)24(40)30(4,5)14-51-57(48,49)54-56(46,47)50-13-19-23(53-55(43,44)45)22(39)28(52-19)37-16-36-21-25(31)34-15-35-26(21)37/h15-19,22-24,28,39-40H,6-14H2,1-5H3,(H,32,38)(H,33,41)(H,46,47)(H,48,49)(H2,31,34,35)(H2,43,44,45)/t18?,19-,22-,23-,24+,28-/m1/s1 |
| InChIKey | GPXWBKWDXPBLKS-LNSOOWQSSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dimethylheptanoyl-CoA (CHEBI:85504) is a medium-chain fatty acyl-CoA (CHEBI:61907) |
| 2,6-dimethylheptanoyl-CoA (CHEBI:85504) is a multi-methyl-branched fatty acyl-CoA (CHEBI:18100) |
| 2,6-dimethylheptanoyl-CoA (CHEBI:85504) is a saturated fatty acyl-CoA (CHEBI:231546) |
| 2,6-dimethylheptanoyl-CoA (CHEBI:85504) is conjugate acid of 2,6-dimethylheptanoyl-CoA(4−) (CHEBI:84847) |
| Incoming Relation(s) |
| (2R)-2,6-dimethylheptanoyl-CoA (CHEBI:87181) is a 2,6-dimethylheptanoyl-CoA (CHEBI:85504) |
| (2S)-2,6-dimethylheptanoyl-CoA (CHEBI:87182) is a 2,6-dimethylheptanoyl-CoA (CHEBI:85504) |
| 2,6-dimethylheptanoyl-CoA(4−) (CHEBI:84847) is conjugate base of 2,6-dimethylheptanoyl-CoA (CHEBI:85504) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21852895 | Reaxys |