EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H45NO5 |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 415.607 |
| Monoisotopic Mass (excl. R groups) | 415.32977 |
| SMILES | *C(=O)O[C@H](CC(=O)[O-])C[N+](C)(C)C |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-(hydroxyhexadecanoyl)-L-carnitine (CHEBI:85459) is a O-(hydroxyhexadecanoyl)carnitine (CHEBI:86030) |
| O-(hydroxyhexadecanoyl)-L-carnitine (CHEBI:85459) is a hydroxy-fatty acyl-L-carnitine (CHEBI:133449) |
| Synonyms | Source |
|---|---|
| O-hydroxyhexadecanoyl-(R)-carnitine | ChEBI |
| O-hydroxyhexadecanoyl-(R)-carnitines | ChEBI |
| O-(hydroxyhexadecanoyl)-L-carnitines | ChEBI |