EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H41NO4 |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 395.576 |
| Monoisotopic Mass (excl. R groups) | 395.30356 |
| SMILES | *C(=O)O[C@H](CC(=O)[O-])C[N+](C)(C)C |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-hexadecadienoyl-L-carnitine (CHEBI:85457) has functional parent hexadecadienoic acid (CHEBI:77524) |
| O-hexadecadienoyl-L-carnitine (CHEBI:85457) has role metabolite (CHEBI:25212) |
| O-hexadecadienoyl-L-carnitine (CHEBI:85457) is a O-acyl-L-carnitine (CHEBI:75659) |
| O-hexadecadienoyl-L-carnitine (CHEBI:85457) is a polyunsaturated fatty acyl-L-carnitine (CHEBI:167110) |
| Synonyms | Source |
|---|---|
| O-hexadecadienoyl-(R)-carnitine | ChEBI |
| O-hexadecadienoyl-(R)-carnitines | ChEBI |
| O-hexadecadienoyl-L-carnitines | ChEBI |