EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H35NO4 |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 341.486 |
| Monoisotopic Mass (excl. R groups) | 341.25661 |
| SMILES | *C(=O)O[C@H](CC(=O)[O-])C[N+](C)(C)C |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-dodecenoyl-L-carnitine (CHEBI:85446) has functional parent dodecenoic acid (CHEBI:23867) |
| O-dodecenoyl-L-carnitine (CHEBI:85446) has role metabolite (CHEBI:25212) |
| O-dodecenoyl-L-carnitine (CHEBI:85446) is a monounsaturated fatty acyl-L-carnitine (CHEBI:133446) |
| Synonyms | Source |
|---|---|
| O-dodecenoyl-(R)-carnitines | ChEBI |
| O-dodecenoyl-(R)-carnitine | ChEBI |
| O-dodecenoyl-L-carnitines | ChEBI |