EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O4 |
| Net Charge | 0 |
| Average Mass | 204.226 |
| Monoisotopic Mass | 204.11101 |
| SMILES | C[C@@H](CO)NC(=O)CC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C8H16N2O4/c1-5(4-11)10-7(12)3-2-6(9)8(13)14/h5-6,11H,2-4,9H2,1H3,(H,10,12)(H,13,14)/t5-,6-/m0/s1 |
| InChIKey | JJWXGBABENFUNJ-WDSKDSINSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas sp. (ncbitaxon:306) | - | PubMed (11976110) | Strain: KIE171 |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(γ-L-glutamyl)-L-alaninol zwitterion (CHEBI:85421) has role bacterial metabolite (CHEBI:76969) |
| N-(γ-L-glutamyl)-L-alaninol zwitterion (CHEBI:85421) is a amino-acid zwitterion (CHEBI:35238) |
| N-(γ-L-glutamyl)-L-alaninol zwitterion (CHEBI:85421) is tautomer of N-(γ-L-glutamyl)-L-alaninol (CHEBI:85894) |
| Incoming Relation(s) |
| N-(γ-L-glutamyl)-L-alaninol (CHEBI:85894) is tautomer of N-(γ-L-glutamyl)-L-alaninol zwitterion (CHEBI:85421) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-5-{[(2S)-1-hydroxypropan-2-yl]amino}-5-oxopentanoate |
| UniProt Name | Source |
|---|---|
| γ-L-glutamyl-L-alaninol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-9373 | MetaCyc |
| Citations |
|---|