EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26N3O13P2 |
| Net Charge | -1 |
| Average Mass | 530.340 |
| Monoisotopic Mass | 530.09463 |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)([O-])OP(=O)([O-])O[C@@H]3C[C@H]([NH3+])[C@H](O)[C@H](C)O3)O2)c(=O)nc1=O |
| InChI | InChI=1S/C16H27N3O13P2/c1-7-5-19(16(23)18-15(7)22)12-4-10(20)11(30-12)6-28-33(24,25)32-34(26,27)31-13-3-9(17)14(21)8(2)29-13/h5,8-14,20-21H,3-4,6,17H2,1-2H3,(H,24,25)(H,26,27)(H,18,22,23)/p-1/t8-,9-,10-,11+,12+,13+,14+/m0/s1 |
| InChIKey | CEQVCLWWGAYCPR-QUTCXQLSSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces peucetius (ncbitaxon:1950) | - | PubMed (15977277) |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dTDP-β-L-daunosamine(1−) (CHEBI:85417) has role bacterial metabolite (CHEBI:76969) |
| dTDP-β-L-daunosamine(1−) (CHEBI:85417) is a nucleotide-sugar oxoanion (CHEBI:59737) |
| dTDP-β-L-daunosamine(1−) (CHEBI:85417) is conjugate base of dTDP-β-L-daunosamine (CHEBI:32340) |
| Incoming Relation(s) |
| dTDP-β-L-daunosamine (CHEBI:32340) is conjugate acid of dTDP-β-L-daunosamine(1−) (CHEBI:85417) |
| UniProt Name | Source |
|---|---|
| dTDP-β-L-daunosamine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-15731 | MetaCyc |