EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10N2O3 |
| Net Charge | 0 |
| Average Mass | 158.157 |
| Monoisotopic Mass | 158.06914 |
| SMILES | CC1=[NH+][C@H](C(=O)[O-])[C@@H](O)CN1 |
| InChI | InChI=1S/C6H10N2O3/c1-3-7-2-4(9)5(8-3)6(10)11/h4-5,9H,2H2,1H3,(H,7,8)(H,10,11)/t4-,5-/m0/s1 |
| InChIKey | KIIBBJKLKFTNQO-WHFBIAKZSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxyectoine zwitterion (CHEBI:85413) is a iminium betaine (CHEBI:35285) |
| 5-hydroxyectoine zwitterion (CHEBI:85413) is tautomer of 5-hydroxyectoine (CHEBI:49432) |
| Incoming Relation(s) |
| 5-hydroxyectoine (CHEBI:49432) is tautomer of 5-hydroxyectoine zwitterion (CHEBI:85413) |
| IUPAC Name |
|---|
| (5S,6S)-5-hydroxy-2-methyl-1,4,5,6-tetrahydropyrimidin-1-ium-6-carboxylate |
| UniProt Name | Source |
|---|---|
| 5-hydroxyectoine | UniProt |
| Citations |
|---|