EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H44N8O18P3S |
| Net Charge | -3 |
| Average Mass | 905.687 |
| Monoisotopic Mass | 905.17236 |
| SMILES | CC(C)(COP(=O)([O-])OP(=O)([O-])OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)([O-])[O-])[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C[N+](C)(C)C |
| InChI | InChI=1S/C28H47N8O18P3S/c1-28(2,23(41)26(42)31-7-6-18(38)30-8-9-58-19(39)10-16(37)11-36(3,4)5)13-51-57(48,49)54-56(46,47)50-12-17-22(53-55(43,44)45)21(40)27(52-17)35-15-34-20-24(29)32-14-33-25(20)35/h14-15,17,21-23,27,40-41H,6-13H2,1-5H3,(H7-,29,30,31,32,33,38,42,43,44,45,46,47,48,49)/p-3/t17-,21-,22-,23+,27-/m1/s1 |
| InChIKey | QNOIWONXQXNHSB-SVHODSNWSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas aeruginosa (ncbitaxon:287) | - | PubMed (19406895) |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-dehydrocarnityl CoA(3−) (CHEBI:85404) has role bacterial metabolite (CHEBI:76969) |
| 3-dehydrocarnityl CoA(3−) (CHEBI:85404) is a acyl-CoA oxoanion (CHEBI:58946) |
| 3-dehydrocarnityl CoA(3−) (CHEBI:85404) is conjugate base of 3-dehydrocarnityl CoA (CHEBI:85886) |
| Incoming Relation(s) |
| 3-dehydrocarnityl CoA (CHEBI:85886) is conjugate acid of 3-dehydrocarnityl CoA(3−) (CHEBI:85404) |
| UniProt Name | Source |
|---|---|
| 3-dehydrocarnityl-CoA | UniProt |
| Citations |
|---|