EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25NO2S2.HCl |
| Net Charge | 0 |
| Average Mass | 412.020 |
| Monoisotopic Mass | 411.10935 |
| SMILES | Cc1ccsc1C(=CCCN1CCC[C@@H](C(=O)O)C1)c1sccc1C.Cl |
| InChI | InChI=1S/C20H25NO2S2.ClH/c1-14-7-11-24-18(14)17(19-15(2)8-12-25-19)6-4-10-21-9-3-5-16(13-21)20(22)23;/h6-8,11-12,16H,3-5,9-10,13H2,1-2H3,(H,22,23);1H/t16-;/m1./s1 |
| InChIKey | YUKARLAABCGMCN-PKLMIRHRSA-N |
| Roles Classification |
|---|
| Biological Role: | GABA reuptake inhibitor A compound that inhibits the re-uptake of the neurotransmitter GABA from the synapse into the pre-synaptic neuron, so increasing the extracellular concentrations of the neurotransmitter and hence increasing neurotransmission. |
| Applications: | GABA reuptake inhibitor A compound that inhibits the re-uptake of the neurotransmitter GABA from the synapse into the pre-synaptic neuron, so increasing the extracellular concentrations of the neurotransmitter and hence increasing neurotransmission. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tiagabine hydrochloride (CHEBI:85388) has part tiagabine(1+) (CHEBI:85387) |
| tiagabine hydrochloride (CHEBI:85388) has role anticonvulsant (CHEBI:35623) |
| tiagabine hydrochloride (CHEBI:85388) has role anxiolytic drug (CHEBI:35474) |
| tiagabine hydrochloride (CHEBI:85388) has role GABA reuptake inhibitor (CHEBI:85384) |
| tiagabine hydrochloride (CHEBI:85388) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| (3R)-1-[4,4-bis(3-methyl-2-thienyl)but-3-en-1-yl]piperidine-3-carboxylic acid hydrochloride |
| Synonyms | Source |
|---|---|
| (3R)-1-[4,4-bis(3-methyl-2-thienyl)but-3-en-1-yl]-3-carboxypiperidinium chloride | IUPAC |
| (3R)-1-[4,4-bis(3-methyl-2-thienyl)but-3-en-1-yl]piperidine-3-carboxylic acid monohydrochloride | ChEBI |
| Abbott-70569.1 | ChemIDplus |
| ABBOTT-705691 | ChEMBL |
| Abbott 70569.HCl | ChemIDplus |
| ABBOTT-70569.HCL | ChEMBL |
| Brand Name | Source |
|---|---|
| Gabitril | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D02097 | KEGG DRUG |
| US2008064727 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6378452 | Reaxys |
| CAS:145821-59-6 | ChemIDplus |
| Citations |
|---|