EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H56O3 |
| Net Charge | 0 |
| Average Mass | 440.753 |
| Monoisotopic Mass | 440.42295 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCCCCCCC(O)C(=O)O |
| InChI | InChI=1S/C28H56O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27(29)28(30)31/h27,29H,2-26H2,1H3,(H,30,31) |
| InChIKey | FYDAGLSVOSNEBV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyoctacosanoic acid (CHEBI:85340) has functional parent octacosanoic acid (CHEBI:31001) |
| 2-hydroxyoctacosanoic acid (CHEBI:85340) is a 2-hydroxy fatty acid (CHEBI:10283) |
| 2-hydroxyoctacosanoic acid (CHEBI:85340) is a ultra-long-chain fatty acid (CHEBI:143004) |
| 2-hydroxyoctacosanoic acid (CHEBI:85340) is conjugate acid of 2-hydroxyoctacosanoate (CHEBI:84313) |
| Incoming Relation(s) |
| (R)-2-hydroxyoctacosanoic acid (CHEBI:76217) is a 2-hydroxyoctacosanoic acid (CHEBI:85340) |
| 2-hydroxyoctacosanoate (CHEBI:84313) is conjugate base of 2-hydroxyoctacosanoic acid (CHEBI:85340) |
| IUPAC Name |
|---|
| 2-hydroxyoctacosanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13246253 | Reaxys |