EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H22N4O5 |
| Net Charge | 0 |
| Average Mass | 314.342 |
| Monoisotopic Mass | 314.15902 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)CNC(=O)/C=C/C(N)=O)C(=O)O |
| InChI | InChI=1S/C13H22N4O5/c1-7(2)5-9(13(21)22)17-12(20)8(14)6-16-11(19)4-3-10(15)18/h3-4,7-9H,5-6,14H2,1-2H3,(H2,15,18)(H,16,19)(H,17,20)(H,21,22)/b4-3+/t8-,9-/m0/s1 |
| InChIKey | MJPKMDAPFRGJGV-FBFNWGNUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pantoea agglomerans (ncbitaxon:549) | - | PubMed (20041689) | Strain: CU0119 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dapdiamide C (CHEBI:85333) is a dapdiamide (CHEBI:85331) |
| dapdiamide C (CHEBI:85333) is a enamide (CHEBI:51751) |
| dapdiamide C (CHEBI:85333) is a primary carboxamide (CHEBI:140324) |
| dapdiamide C (CHEBI:85333) is a secondary carboxamide (CHEBI:140325) |
| dapdiamide C (CHEBI:85333) is tautomer of dapdiamide C zwitterion (CHEBI:84322) |
| Incoming Relation(s) |
| dapdiamide C zwitterion (CHEBI:84322) is tautomer of dapdiamide C (CHEBI:85333) |
| IUPAC Name |
|---|
| 3-{[(2E)-4-amino-4-oxobut-2-enoyl]amino}-L-alanyl-L-leucine |
| Manual Xrefs | Databases |
|---|---|
| CPD-17541 | MetaCyc |
| Citations |
|---|