EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H37N7O19P3S |
| Net Charge | -5 |
| Average Mass | 876.601 |
| Monoisotopic Mass | 876.11052 |
| SMILES | CC[C@H](C(=O)[O-])C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)([O-])[O-] |
| InChI | InChI=1S/C26H42N7O19P3S/c1-4-13(24(38)39)25(40)56-8-7-28-15(34)5-6-29-22(37)19(36)26(2,3)10-49-55(46,47)52-54(44,45)48-9-14-18(51-53(41,42)43)17(35)23(50-14)33-12-32-16-20(27)30-11-31-21(16)33/h11-14,17-19,23,35-36H,4-10H2,1-3H3,(H,28,34)(H,29,37)(H,38,39)(H,44,45)(H,46,47)(H2,27,30,31)(H2,41,42,43)/p-5/t13-,14-,17-,18-,19+,23-/m1/s1 |
| InChIKey | VUGZQVCBBBEZQE-XGVFZYDCSA-I |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-ethylmalonyl-CoA(5−) (CHEBI:85316) is a carboxylic acid anion (CHEBI:29067) |
| (R)-ethylmalonyl-CoA(5−) (CHEBI:85316) is a ω-carboxy-(fatty acyl)-CoA(5−) (CHEBI:177898) |
| (R)-ethylmalonyl-CoA(5−) (CHEBI:85316) is a ω-carboxyacyl-CoA(5−) (CHEBI:133241) |
| (R)-ethylmalonyl-CoA(5−) (CHEBI:85316) is conjugate base of (R)-ethylmalonyl-CoA (CHEBI:85803) |
| Incoming Relation(s) |
| (R)-ethylmalonyl-CoA (CHEBI:85803) is conjugate acid of (R)-ethylmalonyl-CoA(5−) (CHEBI:85316) |
| UniProt Name | Source |
|---|---|
| (2R)-ethylmalonyl-CoA | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-17635 | MetaCyc |