EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H21NO2 |
| Net Charge | 0 |
| Average Mass | 187.283 |
| Monoisotopic Mass | 187.15723 |
| SMILES | CCCCCCCC(=O)NCCO |
| InChI | InChI=1S/C10H21NO2/c1-2-3-4-5-6-7-10(13)11-8-9-12/h12H,2-9H2,1H3,(H,11,13) |
| InChIKey | GSILMNFJLONLCJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(octanoyl)ethanolamine (CHEBI:85302) has functional parent octanoic acid (CHEBI:28837) |
| N-(octanoyl)ethanolamine (CHEBI:85302) is a N-(saturated fatty acyl)ethanolamine (CHEBI:85283) |
| IUPAC Name |
|---|
| N-(2-hydroxyethyl)octanamide |
| Synonyms | Source |
|---|---|
| capryloyl ethanolamide | SUBMITTER |
| capryloyl MEA amide | ChEBI |
| N-(2-hydroxylethyl)caprylic acid amide | ChEBI |
| MEA amide of octanoic acid | ChEBI |
| N-octanoyl-2-aminoethanol | ChEBI |
| N-octanoylethanolamine | ChEBI |
| UniProt Name | Source |
|---|---|
| N-octanoyl ethanolamine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:606457 | Reaxys |
| Citations |
|---|