EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19N4 |
| Net Charge | +1 |
| Average Mass | 243.334 |
| Monoisotopic Mass | 243.16042 |
| SMILES | CCCc1ncc(C[n+]2ccccc2C)c(N)n1 |
| InChI | InChI=1S/C14H19N4/c1-3-6-13-16-9-12(14(15)17-13)10-18-8-5-4-7-11(18)2/h4-5,7-9H,3,6,10H2,1-2H3,(H2,15,16,17)/q+1 |
| InChIKey | IPZFPROOBOUEIG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | coccidiostat An agent useful in the treatment or prevention of coccidiosis in man or animals. |
| Application: | coccidiostat An agent useful in the treatment or prevention of coccidiosis in man or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amprolium(1+) (CHEBI:85266) has role coccidiostat (CHEBI:35818) |
| amprolium(1+) (CHEBI:85266) is a pyridinium ion (CHEBI:50334) |
| Incoming Relation(s) |
| amprolium (CHEBI:85265) has part amprolium(1+) (CHEBI:85266) |
| IUPAC Name |
|---|
| 1-[(4-amino-2-propylpyrimidin-5-yl)methyl]-2-methylpyridin-1-ium |
| Synonym | Source |
|---|---|
| amprolium cation | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-6688 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4149652 | Reaxys |