EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8NO5.K |
| Net Charge | 0 |
| Average Mass | 237.252 |
| Monoisotopic Mass | 237.00395 |
| SMILES | [H][C@@]12CC(=O)N1[C@@H](C(=O)[O-])/C(=C/CO)O2.[K+] |
| InChI | InChI=1S/C8H9NO5.K/c10-2-1-4-7(8(12)13)9-5(11)3-6(9)14-4;/h1,6-7,10H,2-3H2,(H,12,13);/q;+1/p-1/b4-1-;/t6-,7-;/m1./s1 |
| InChIKey | ABVRVIZBZKUTMK-JSYANWSFSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. EC 3.5.2.6 (beta-lactamase) inhibitor An EC 3.5.2.* (non-peptide cyclic amide C-N hydrolase) inhibitor that interferes with the action of β-lactamase (EC 3.5.2.6). antibacterial drug A drug used to treat or prevent bacterial infections. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| potassium clavulanate (CHEBI:85264) has part clavulanate (CHEBI:487869) |
| potassium clavulanate (CHEBI:85264) has role antibacterial drug (CHEBI:36047) |
| potassium clavulanate (CHEBI:85264) has role antimicrobial agent (CHEBI:33281) |
| potassium clavulanate (CHEBI:85264) has role EC 3.5.2.6 (β-lactamase) inhibitor (CHEBI:35625) |
| potassium clavulanate (CHEBI:85264) is a potassium salt (CHEBI:26218) |
| Incoming Relation(s) |
| Augmentin (CHEBI:2677) has part potassium clavulanate (CHEBI:85264) |
| IUPAC Name |
|---|
| potassium (2R,3Z,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| Synonyms | Source |
|---|---|
| CVA | KEGG DRUG |
| Clavulanate potassium | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D02370 | KEGG DRUG |
| DB00766 | DrugBank |
| Clavulanic_Acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4773605 | Reaxys |
| CAS:61177-45-5 | KEGG DRUG |
| CAS:61177-45-5 | ChemIDplus |