EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H74N2O14 |
| Net Charge | 0 |
| Average Mass | 843.065 |
| Monoisotopic Mass | 842.51401 |
| SMILES | CO[C@@H]1[C@@H](O[C@@H]2O[C@H](C)[C@@H](O[C@H]3C[C@@](C)(O)[C@@H](O)[C@H](C)O3)[C@H](N(C)C)[C@H]2O)[C@@H](CC=O)C[C@@H](C)[C@@H](O[C@H]2CC[C@H](N(C)C)[C@H](C)O2)/C=C/C=C/C[C@@H](C)OC(=O)C[C@H]1O |
| InChI | InChI=1S/C43H74N2O14/c1-24-21-29(19-20-46)39(59-42-37(49)36(45(9)10)38(27(4)56-42)58-35-23-43(6,51)41(50)28(5)55-35)40(52-11)31(47)22-33(48)53-25(2)15-13-12-14-16-32(24)57-34-18-17-30(44(7)8)26(3)54-34/h12-14,16,20,24-32,34-42,47,49-51H,15,17-19,21-23H2,1-11H3/b13-12+,16-14+/t24-,25-,26+,27-,28+,29+,30+,31-,32+,34+,35+,36-,37-,38-,39+,40+,41+,42+,43-/m1/s1 |
| InChIKey | ACTOXUHEUCPTEW-KWBWCIJSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces spiramyceticus (ncbitaxon:299717) | - | PubMed (17849607) | Strain: F21 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial drug A drug used to treat or prevent bacterial infections. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spiramycin I (CHEBI:85260) has role antibacterial drug (CHEBI:36047) |
| spiramycin I (CHEBI:85260) has role antimicrobial agent (CHEBI:33281) |
| spiramycin I (CHEBI:85260) has role bacterial metabolite (CHEBI:76969) |
| spiramycin I (CHEBI:85260) is a aldehyde (CHEBI:17478) |
| spiramycin I (CHEBI:85260) is a disaccharide derivative (CHEBI:63353) |
| spiramycin I (CHEBI:85260) is a ether (CHEBI:25698) |
| spiramycin I (CHEBI:85260) is a macrolide (CHEBI:25106) |
| spiramycin I (CHEBI:85260) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| [(4R,5S,6S,7R,9R,10R,11E,13E,16R)-6-{[(2S,3R,4R,5S,6R)-5-{[(2S,4R,5S,6S)-4,5-dihydroxy-4,6-dimethyloxan-2-yl]oxy}-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy}-10-{[(2R,5S,6S)-5-(dimethylamino)-6-methyloxan-2-yl]oxy}-4-hydroxy-5-methoxy-9,16-dimethyl-2-oxo-1-oxacyclohexadeca-11,13-dien-7-yl]acetaldehyde |
| Synonyms | Source |
|---|---|
| Demycarosylturimycin H | ChemIDplus |
| foromacidin A | ChEBI |
| Foromacidine A | ChemIDplus |
| Spiramycin | KEGG COMPOUND |
| Spiramycin 1 | ChemIDplus |
| Spiramycin A | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CPD-13983 | MetaCyc |
| LMPK04000005 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21729639 | Reaxys |
| CAS:24916-50-5 | ChemIDplus |
| Citations |
|---|