EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H37NO2 |
| Net Charge | 0 |
| Average Mass | 371.565 |
| Monoisotopic Mass | 371.28243 |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCO |
| InChI | InChI=1S/C24H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24(27)25-22-23-26/h3-4,6-7,9-10,12-13,15-16,18-19,26H,2,5,8,11,14,17,20-23H2,1H3,(H,25,27)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | GEEHOLRSGZPBSM-KUBAVDMBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoylethanolamine (CHEBI:85252) has functional parent all-cis-docosa-4,7,10,13,16,19-hexaenoic acid (CHEBI:28125) |
| N-(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoylethanolamine (CHEBI:85252) is a N-acylethanolamine 22:6 (CHEBI:134165) |
| N-(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoylethanolamine (CHEBI:85252) is a endocannabinoid (CHEBI:67197) |
| IUPAC Name |
|---|
| (4Z,7Z,10Z,13Z,16Z,19Z)-N-(2-hydroxyethyl)docosa-4,7,10,13,16,19-hexaenamide |
| Synonyms | Source |
|---|---|
| Anandamide (22:6, n-3) | LIPID MAPS |
| N-cis-4,7,10,13,16,19-docosahexanoylethanolamine | LIPID MAPS |
| N-(4Z,7Z,10Z,13Z,16Z,19Z-docosahexaenoyl)-ethanolamine | LIPID MAPS |
| UniProt Name | Source |
|---|---|
| N-(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl ethanolamine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| LMFA08040009 | LIPID MAPS |
| HMDB0013658 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7653452 | Reaxys |
| Citations |
|---|