EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28N4O4 |
| Net Charge | 0 |
| Average Mass | 328.413 |
| Monoisotopic Mass | 328.21106 |
| SMILES | [H][C@@]1([C@@H](NC(C)=O)C(CC)CC)[C@H](O)[C@@H](C(=O)O)C[C@H]1NC(=N)N |
| InChI | InChI=1S/C15H28N4O4/c1-4-8(5-2)12(18-7(3)20)11-10(19-15(16)17)6-9(13(11)21)14(22)23/h8-13,21H,4-6H2,1-3H3,(H,18,20)(H,22,23)(H4,16,17,19)/t9-,10+,11+,12-,13+/m0/s1 |
| InChIKey | XRQDFNLINLXZLB-CKIKVBCHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Applications: | EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| peramivir (CHEBI:85202) has part peramivir hydrate (CHEBI:85196) |
| peramivir (CHEBI:85202) has role antiviral drug (CHEBI:36044) |
| peramivir (CHEBI:85202) has role EC 3.2.1.18 (exo-α-sialidase) inhibitor (CHEBI:52425) |
| peramivir (CHEBI:85202) is a 3-hydroxy monocarboxylic acid (CHEBI:35969) |
| peramivir (CHEBI:85202) is a acetamides (CHEBI:22160) |
| peramivir (CHEBI:85202) is a cyclopentanols (CHEBI:23495) |
| peramivir (CHEBI:85202) is a guanidines (CHEBI:24436) |
| IUPAC Name |
|---|
| (1S,2S,3R,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-carbamimidamido-2-hydroxycyclopentane-1-carboxylic acid |
| Synonyms | Source |
|---|---|
| 3-(1'-acetylamino-2'-ethyl)butyl-4-((aminoimino)methyl)amino-2-hydroxycyclopentane-1-carboxylic acid | ChemIDplus |
| BCX 1812 | ChemIDplus |
| BCX-1812 | ChemIDplus |
| BCX1812 | ChemIDplus |
| RWJ 270201 | ChemIDplus |
| RWJ-270201 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9011170 | Reaxys |
| CAS:330600-85-6 | ChemIDplus |
| Citations |
|---|