EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H43N7O7S |
| Net Charge | 0 |
| Average Mass | 765.893 |
| Monoisotopic Mass | 765.29447 |
| SMILES | [H][C@@]12C[C@@H](Oc3nc4ccccc4c4ccccc34)CN1C(=O)[C@@H](NC(=O)c1cnc(C)cn1)CCCCC/C=C\[C@@]1([H])C[C@@]1(C(=O)NS(=O)(=O)C1CC1)NC2=O |
| InChI | InChI=1S/C40H43N7O7S/c1-24-21-42-33(22-41-24)35(48)43-32-16-6-4-2-3-5-11-25-20-40(25,39(51)46-55(52,53)27-17-18-27)45-36(49)34-19-26(23-47(34)38(32)50)54-37-30-14-8-7-12-28(30)29-13-9-10-15-31(29)44-37/h5,7-15,21-22,25-27,32,34H,2-4,6,16-20,23H2,1H3,(H,43,48)(H,45,49)(H,46,51)/b11-5-/t25-,26+,32-,34-,40+/m0/s1 |
| InChIKey | UAUIUKWPKRJZJV-MDJGTQRPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. hepatitis C protease inhibitor An inhibitor of hepatitis C protease, an enzyme required for production of proteins needed for viral assembly. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paritaprevir (CHEBI:85188) has role antiviral drug (CHEBI:36044) |
| paritaprevir (CHEBI:85188) has role hepatitis C protease inhibitor (CHEBI:64924) |
| paritaprevir (CHEBI:85188) is a N-sulfonylcarboxamide (CHEBI:90852) |
| paritaprevir (CHEBI:85188) is a aromatic amide (CHEBI:62733) |
| paritaprevir (CHEBI:85188) is a aromatic ether (CHEBI:35618) |
| paritaprevir (CHEBI:85188) is a azamacrocycle (CHEBI:52898) |
| paritaprevir (CHEBI:85188) is a cyclopropanes (CHEBI:51454) |
| paritaprevir (CHEBI:85188) is a lactam (CHEBI:24995) |
| paritaprevir (CHEBI:85188) is a phenanthridines (CHEBI:51245) |
| paritaprevir (CHEBI:85188) is a pyrazines (CHEBI:38314) |
| Incoming Relation(s) |
| Technivie (CHEBI:90919) has part paritaprevir (CHEBI:85188) |
| Viekira Pak (CHEBI:85177) has part paritaprevir (CHEBI:85188) |
| IUPAC Name |
|---|
| (2R,6S,12Z,13aR,14aR,16aS)-N-(cyclopropanesulfonyl)-6-[(5-methylpyrazine-2-carbonyl)amino]-5,16-dioxo-2-[(phenanthridin-6-yl)oxy]-1,2,3,6,7,8,9,10,11,13a,14,15,16,16a-tetradecahydrocyclopropa[e]pyrrolo[1,2-a][1,4]diazacyclopentadecine-14a(5H)-carboxamide |
| Synonyms | Source |
|---|---|
| ABT 450 | ChemIDplus |
| ABT450 | ChemIDplus |
| Veruprevir | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D10580 | KEGG DRUG |
| Paritaprevir | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1216941-48-8 | KEGG DRUG |
| CAS:1216941-48-8 | ChemIDplus |
| Citations |
|---|