EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C50H67N7O8 |
| Net Charge | 0 |
| Average Mass | 894.127 |
| Monoisotopic Mass | 893.50511 |
| SMILES | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)Nc1ccc([C@@H]2CC[C@@H](c3ccc(NC(=O)[C@@H]4CCCN4C(=O)[C@@H](NC(=O)OC)C(C)C)cc3)N2c2ccc(C(C)(C)C)cc2)cc1)C(C)C |
| InChI | InChI=1S/C50H67N7O8/c1-30(2)42(53-48(62)64-8)46(60)55-28-10-12-40(55)44(58)51-35-20-14-32(15-21-35)38-26-27-39(57(38)37-24-18-34(19-25-37)50(5,6)7)33-16-22-36(23-17-33)52-45(59)41-13-11-29-56(41)47(61)43(31(3)4)54-49(63)65-9/h14-25,30-31,38-43H,10-13,26-29H2,1-9H3,(H,51,58)(H,52,59)(H,53,62)(H,54,63)/t38-,39-,40-,41-,42-,43-/m0/s1 |
| InChIKey | PIDFDZJZLOTZTM-KHVQSSSXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. hepatitis C virus nonstructural protein 5A inhibitor Any inhibitor of hepatitis C virus nonstructural protein 5A. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ombitasvir (CHEBI:85183) has functional parent Val-Pro (CHEBI:73701) |
| ombitasvir (CHEBI:85183) has role antiviral drug (CHEBI:36044) |
| ombitasvir (CHEBI:85183) has role hepatitis C virus nonstructural protein 5A inhibitor (CHEBI:85185) |
| ombitasvir (CHEBI:85183) is a aromatic amide (CHEBI:62733) |
| ombitasvir (CHEBI:85183) is a carbamate ester (CHEBI:23003) |
| ombitasvir (CHEBI:85183) is a dipeptide (CHEBI:46761) |
| ombitasvir (CHEBI:85183) is a pyrrolidines (CHEBI:38260) |
| Incoming Relation(s) |
| Technivie (CHEBI:90919) has part ombitasvir (CHEBI:85183) |
| Viekira Pak (CHEBI:85177) has part ombitasvir (CHEBI:85183) |
| IUPAC Name |
|---|
| dimethyl ([(2S,5S)-1-(4-tert-butylphenyl)pyrrolidine-2,5-diyl]bis{(4,1-phenylene)carbamoyl(2S)pyrrolidine-2,1-diyl[(2S)-3-methyl-1-oxobutane-1,2-diyl]})biscarbamate |
| INN | Source |
|---|---|
| ombitasvir | ChemIDplus |
| Synonyms | Source |
|---|---|
| ABT 267 | ChemIDplus |
| ABT-267 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4912 | DrugCentral |
| D10576 | KEGG DRUG |
| Ombitasvir | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24582175 | Reaxys |
| CAS:1258226-87-7 | KEGG DRUG |
| CAS:1258226-87-7 | ChemIDplus |
| Citations |
|---|